Difference between revisions of "SJ04588"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-DEOH-DEOXY-MANNOSE DTDP-DEOH-DEOXY-MANNOSE] == * common-name: ** dtdp-4-dehydro-β-l-r...")
(Created page with "Category:gene == Gene SJ20503 == * transcription-direction: ** positive * right-end-position: ** 24374 * left-end-position: ** 11197 * centisome-position: ** 5.3986163...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-DEOH-DEOXY-MANNOSE DTDP-DEOH-DEOXY-MANNOSE] ==
+
== Gene SJ20503 ==
−
* common-name:
+
* transcription-direction:
−
** dtdp-4-dehydro-β-l-rhamnose
+
** positive
−
* smiles:
+
* right-end-position:
−
** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(=o)c(o)c(o)2))o3))
+
** 24374
−
* inchi-key:
+
* left-end-position:
−
** psxwnitxwwecny-lpvgzgshsa-l
+
** 11197
−
* molecular-weight:
+
* centisome-position:
−
** 544.302
+
** 5.3986163   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[DTDPDEHYRHAMREDUCT-RXN]]
+
* [[S.japonica_sterols_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
* [[DTDPDEHYDRHAMEPIM-RXN]]
+
* [[2.7.10.1-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
−
{{#set: common-name=dtdp-4-dehydro-β-l-rhamnose}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: inchi-key=inchikey=psxwnitxwwecny-lpvgzgshsa-l}}
+
* [[2.7.12.1-RXN]]
−
{{#set: molecular-weight=544.302}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[PROTEIN-KINASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-14906]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=24374}}
 +
{{#set: left-end-position=11197}}
 +
{{#set: centisome-position=5.3986163    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=4}}

Revision as of 20:19, 18 December 2020

Gene SJ20503

  • transcription-direction:
    • positive
  • right-end-position:
    • 24374
  • left-end-position:
    • 11197
  • centisome-position:
    • 5.3986163

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ04588&oldid=40783"