Difference between revisions of "SJ04591"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-196 CPD-196] == * common-name: ** octanoyl-coa * smiles: ** cccccccc(=o)sccnc(=o)ccnc(=o)c(...")
(Created page with "Category:gene == Gene SJ04591 == * transcription-direction: ** negative * right-end-position: ** 212832 * left-end-position: ** 207444 * centisome-position: ** 40.818317...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-196 CPD-196] ==
+
== Gene SJ04591 ==
−
* common-name:
+
* transcription-direction:
−
** octanoyl-coa
+
** negative
−
* smiles:
+
* right-end-position:
−
** cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 212832
−
* inchi-key:
+
* left-end-position:
−
** kqmzyoxobsxmii-cecatxlmsa-j
+
** 207444
−
* molecular-weight:
+
* centisome-position:
−
** 889.7
+
** 40.818317   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[3.1.2.19-RXN-CPD-196/WATER//CPD-195/CO-A/PROTON.35.]]
+
* [[S.japonica_carotenoid_curated]]
−
* [[ACACT4]]
+
== Reaction(s) associated ==
−
* [[ACACT4h]]
+
* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
−
* [[ACECOATRANS-RXN-CPD-196/ACET//CPD-195/ACETYL-COA.33.]]
+
** Category: [[annotation]]
−
* [[ACOA80OR]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN-12669]]
+
{{#set: transcription-direction=negative}}
−
* [[RXN-14229]]
+
{{#set: right-end-position=212832}}
−
* [[THIOESTER-RXN[CCO-CYTOSOL]-CPD-196/WATER//CPD-195/CO-A/PROTON.48.]]
+
{{#set: left-end-position=207444}}
−
== Reaction(s) known to produce the compound ==
+
{{#set: centisome-position=40.818317    }}
−
* [[ACACT4]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
−
* [[R223-RXN]]
+
{{#set: nb reaction associated=1}}
−
* [[RXN-13617]]
 
−
* [[RXN-14229]]
 
−
== Reaction(s) of unknown directionality ==
 
−
{{#set: common-name=octanoyl-coa}}
 
−
{{#set: inchi-key=inchikey=kqmzyoxobsxmii-cecatxlmsa-j}}
 
−
{{#set: molecular-weight=889.7}}
 

Latest revision as of 11:04, 18 March 2021

Gene SJ04591

  • transcription-direction:
    • negative
  • right-end-position:
    • 212832
  • left-end-position:
    • 207444
  • centisome-position:
    • 40.818317

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ04591&oldid=133359"