Difference between revisions of "SJ04591"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-196 CPD-196] == * common-name: ** octanoyl-coa * smiles: ** cccccccc(=o)sccnc(=o)ccnc(=o)c(...")
(Created page with "Category:gene == Gene SJ09077 == * transcription-direction: ** positive * right-end-position: ** 104720 * left-end-position: ** 99468 * centisome-position: ** 23.341953...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-196 CPD-196] ==
+
== Gene SJ09077 ==
* common-name:
+
* transcription-direction:
** octanoyl-coa
+
** positive
* smiles:
+
* right-end-position:
** cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 104720
* inchi-key:
+
* left-end-position:
** kqmzyoxobsxmii-cecatxlmsa-j
+
** 99468
* molecular-weight:
+
* centisome-position:
** 889.7
+
** 23.341953   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[3.1.2.19-RXN-CPD-196/WATER//CPD-195/CO-A/PROTON.35.]]
+
* [[S.japonica_sterols_curated]]
* [[ACACT4]]
+
== Reaction(s) associated ==
* [[ACACT4h]]
+
* [[2.7.11.7-RXN]]
* [[ACECOATRANS-RXN-CPD-196/ACET//CPD-195/ACETYL-COA.33.]]
+
** Category: [[annotation]]
* [[ACOA80OR]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-12669]]
+
* [[PROTEIN-KINASE-RXN]]
* [[RXN-14229]]
+
** Category: [[annotation]]
* [[THIOESTER-RXN[CCO-CYTOSOL]-CPD-196/WATER//CPD-195/CO-A/PROTON.48.]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
== Reaction(s) known to produce the compound ==
+
{{#set: transcription-direction=positive}}
* [[ACACT4]]
+
{{#set: right-end-position=104720}}
* [[R223-RXN]]
+
{{#set: left-end-position=99468}}
* [[RXN-13617]]
+
{{#set: centisome-position=23.341953    }}
* [[RXN-14229]]
+
{{#set: organism associated=S.japonica_sterols_curated}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb reaction associated=2}}
{{#set: common-name=octanoyl-coa}}
 
{{#set: inchi-key=inchikey=kqmzyoxobsxmii-cecatxlmsa-j}}
 
{{#set: molecular-weight=889.7}}
 

Revision as of 20:22, 18 December 2020

Gene SJ09077

  • transcription-direction:
    • positive
  • right-end-position:
    • 104720
  • left-end-position:
    • 99468
  • centisome-position:
    • 23.341953

Organism(s) associated with this gene

Reaction(s) associated