Difference between revisions of "SJ04599"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYPOXANTHINE HYPOXANTHINE] == * common-name: ** hypoxanthine * smiles: ** c1(nc2(=c(n=1)n=cnc(=...")
(Created page with "Category:gene == Gene SJ04599 == * transcription-direction: ** positive * right-end-position: ** 376647 * left-end-position: ** 355312 * centisome-position: ** 69.913994...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYPOXANTHINE HYPOXANTHINE] ==
+
== Gene SJ04599 ==
* common-name:
+
* transcription-direction:
** hypoxanthine
+
** positive
* smiles:
+
* right-end-position:
** c1(nc2(=c(n=1)n=cnc(=o)2))
+
** 376647
* inchi-key:
+
* left-end-position:
** fdgqstzjbfjubt-uhfffaoysa-n
+
** 355312
* molecular-weight:
+
* centisome-position:
** 136.113
+
** 69.913994   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[DEOXYINOPHOSPHOR-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[HPRT]]
+
== Reaction(s) associated ==
* [[HYPOXANPRIBOSYLTRAN-RXN]]
+
* [[PROTEIN-KINASE-RXN]]
* [[INOPHOSPHOR-RXN]]
+
** Category: [[annotation]]
* [[RXN-7682]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[XANDH]]
+
* [[RXN-8443]]
== Reaction(s) known to produce the compound ==
+
** Category: [[orthology]]
* [[DEOXYINOPHOSPHOR-RXN]]
+
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
* [[HPRT]]
+
== Pathway(s) associated ==
* [[INOPHOSPHOR-RXN]]
+
* [[PWY-5381]]
== Reaction(s) of unknown directionality ==
+
** '''6''' reactions found over '''11''' reactions in the full pathway
{{#set: common-name=hypoxanthine}}
+
{{#set: transcription-direction=positive}}
{{#set: inchi-key=inchikey=fdgqstzjbfjubt-uhfffaoysa-n}}
+
{{#set: right-end-position=376647}}
{{#set: molecular-weight=136.113}}
+
{{#set: left-end-position=355312}}
 +
{{#set: centisome-position=69.913994    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:04, 18 March 2021

Gene SJ04599

  • transcription-direction:
    • positive
  • right-end-position:
    • 376647
  • left-end-position:
    • 355312
  • centisome-position:
    • 69.913994

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-5381
    • 6 reactions found over 11 reactions in the full pathway