Difference between revisions of "SJ04599"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ22250 == * transcription-direction: ** positive * right-end-position: ** 51022 * left-end-position: ** 46466 * centisome-position: ** 26.010973...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYPOXANTHINE HYPOXANTHINE] == * common-name: ** hypoxanthine * smiles: ** c1(nc2(=c(n=1)n=cnc(=...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYPOXANTHINE HYPOXANTHINE] == |
− | * | + | * common-name: |
− | ** | + | ** hypoxanthine |
− | * | + | * smiles: |
− | ** | + | ** c1(nc2(=c(n=1)n=cnc(=o)2)) |
− | * | + | * inchi-key: |
− | ** | + | ** fdgqstzjbfjubt-uhfffaoysa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 136.113 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[DEOXYINOPHOSPHOR-RXN]] | |
− | == Reaction(s) | + | * [[HPRT]] |
− | * [[ | + | * [[HYPOXANPRIBOSYLTRAN-RXN]] |
− | * | + | * [[INOPHOSPHOR-RXN]] |
− | * | + | * [[RXN-7682]] |
− | + | * [[XANDH]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[DEOXYINOPHOSPHOR-RXN]] | |
− | + | * [[HPRT]] | |
− | + | * [[INOPHOSPHOR-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[RXN- | + | {{#set: common-name=hypoxanthine}} |
− | * | + | {{#set: inchi-key=inchikey=fdgqstzjbfjubt-uhfffaoysa-n}} |
− | + | {{#set: molecular-weight=136.113}} | |
− | * [[RXN | ||
− | * | ||
− | * | ||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 14:20, 26 August 2019
Contents
Metabolite HYPOXANTHINE
- common-name:
- hypoxanthine
- smiles:
- c1(nc2(=c(n=1)n=cnc(=o)2))
- inchi-key:
- fdgqstzjbfjubt-uhfffaoysa-n
- molecular-weight:
- 136.113