Difference between revisions of "SJ04599"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ22250 == * transcription-direction: ** positive * right-end-position: ** 51022 * left-end-position: ** 46466 * centisome-position: ** 26.010973...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYPOXANTHINE HYPOXANTHINE] == * common-name: ** hypoxanthine * smiles: ** c1(nc2(=c(n=1)n=cnc(=...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ22250 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYPOXANTHINE HYPOXANTHINE] ==
* transcription-direction:
+
* common-name:
** positive
+
** hypoxanthine
* right-end-position:
+
* smiles:
** 51022
+
** c1(nc2(=c(n=1)n=cnc(=o)2))
* left-end-position:
+
* inchi-key:
** 46466
+
** fdgqstzjbfjubt-uhfffaoysa-n
* centisome-position:
+
* molecular-weight:
** 26.010973   
+
** 136.113
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[DEOXYINOPHOSPHOR-RXN]]
== Reaction(s) associated ==
+
* [[HPRT]]
* [[1.1.1.141-RXN]]
+
* [[HYPOXANPRIBOSYLTRAN-RXN]]
** Category: [[annotation]]
+
* [[INOPHOSPHOR-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-7682]]
* [[ATPASE-RXN]]
+
* [[XANDH]]
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[DEOXYINOPHOSPHOR-RXN]]
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
* [[HPRT]]
** Category: [[annotation]]
+
* [[INOPHOSPHOR-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
* [[RXN-12195]]
+
{{#set: common-name=hypoxanthine}}
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=fdgqstzjbfjubt-uhfffaoysa-n}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=136.113}}
* [[RXN-12196]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN0-5462]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY-7210]]
 
** '''8''' reactions found over '''8''' reactions in the full pathway
 
* [[PWY-7198]]
 
** '''6''' reactions found over '''7''' reactions in the full pathway
 
* [[PWY-7184]]
 
** '''9''' reactions found over '''9''' reactions in the full pathway
 
* [[PWY-6545]]
 
** '''8''' reactions found over '''9''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=51022}}
 
{{#set: left-end-position=46466}}
 
{{#set: centisome-position=26.010973    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=6}}
 
{{#set: nb pathway associated=4}}
 

Revision as of 14:20, 26 August 2019

Metabolite HYPOXANTHINE

  • common-name:
    • hypoxanthine
  • smiles:
    • c1(nc2(=c(n=1)n=cnc(=o)2))
  • inchi-key:
    • fdgqstzjbfjubt-uhfffaoysa-n
  • molecular-weight:
    • 136.113

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality