Difference between revisions of "SJ04599"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYPOXANTHINE HYPOXANTHINE] == * common-name: ** hypoxanthine * smiles: ** c1(nc2(=c(n=1)n=cnc(=...")
(Created page with "Category:gene == Gene SJ22151 == * transcription-direction: ** negative * right-end-position: ** 33399 * left-end-position: ** 30272 * centisome-position: ** 16.80676...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYPOXANTHINE HYPOXANTHINE] ==
+
== Gene SJ22151 ==
* common-name:
+
* transcription-direction:
** hypoxanthine
+
** negative
* smiles:
+
* right-end-position:
** c1(nc2(=c(n=1)n=cnc(=o)2))
+
** 33399
* inchi-key:
+
* left-end-position:
** fdgqstzjbfjubt-uhfffaoysa-n
+
** 30272
* molecular-weight:
+
* centisome-position:
** 136.113
+
** 16.80676   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[DEOXYINOPHOSPHOR-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[HPRT]]
+
== Reaction(s) associated ==
* [[HYPOXANPRIBOSYLTRAN-RXN]]
+
* [[ATPASE-RXN]]
* [[INOPHOSPHOR-RXN]]
+
** Category: [[annotation]]
* [[RXN-7682]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[XANDH]]
+
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
* [[DEOXYINOPHOSPHOR-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[HPRT]]
+
* [[RXN-12195]]
* [[INOPHOSPHOR-RXN]]
+
** Category: [[annotation]]
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: common-name=hypoxanthine}}
+
* [[RXN-12196]]
{{#set: inchi-key=inchikey=fdgqstzjbfjubt-uhfffaoysa-n}}
+
** Category: [[annotation]]
{{#set: molecular-weight=136.113}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN0-5462]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-7210]]
 +
** '''8''' reactions found over '''8''' reactions in the full pathway
 +
* [[PWY-7198]]
 +
** '''6''' reactions found over '''7''' reactions in the full pathway
 +
* [[PWY-7184]]
 +
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
* [[PWY-6545]]
 +
** '''8''' reactions found over '''9''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=33399}}
 +
{{#set: left-end-position=30272}}
 +
{{#set: centisome-position=16.80676    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=5}}
 +
{{#set: nb pathway associated=4}}

Revision as of 09:25, 27 August 2019

Gene SJ22151

  • transcription-direction:
    • negative
  • right-end-position:
    • 33399
  • left-end-position:
    • 30272
  • centisome-position:
    • 16.80676

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7210
    • 8 reactions found over 8 reactions in the full pathway
  • PWY-7198
    • 6 reactions found over 7 reactions in the full pathway
  • PWY-7184
    • 9 reactions found over 9 reactions in the full pathway
  • PWY-6545
    • 8 reactions found over 9 reactions in the full pathway