Difference between revisions of "SJ04615"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14874 CPD-14874] == * common-name: ** grixazone a * smiles: ** cc(=o)nc(c([o-])=o)csc1(=c(n...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8080 CPD-8080] == * common-name: ** 1-18:2-2-16:3-monogalactosyldiacylglycerol * smiles: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14874 CPD-14874] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8080 CPD-8080] ==
 
* common-name:
 
* common-name:
** grixazone a
+
** 1-18:2-2-16:3-monogalactosyldiacylglycerol
 
* smiles:
 
* smiles:
** cc(=o)nc(c([o-])=o)csc1(=c(n)c(=o)c=c2(c1=nc3(c(o2)=cc=c([ch]=o)c=3)))
+
** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o
 
* inchi-key:
 
* inchi-key:
** cbxhedpbkozzsi-nshdsacasa-m
+
** dvrkgrmgqjlnpc-nidyupdjsa-n
 
* molecular-weight:
 
* molecular-weight:
** 400.385
+
** 749.036
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-8301]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13868]]
+
* [[RXN-8306]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=grixazone a}}
+
{{#set: common-name=1-18:2-2-16:3-monogalactosyldiacylglycerol}}
{{#set: inchi-key=inchikey=cbxhedpbkozzsi-nshdsacasa-m}}
+
{{#set: inchi-key=inchikey=dvrkgrmgqjlnpc-nidyupdjsa-n}}
{{#set: molecular-weight=400.385}}
+
{{#set: molecular-weight=749.036}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-8080

  • common-name:
    • 1-18:2-2-16:3-monogalactosyldiacylglycerol
  • smiles:
    • cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o
  • inchi-key:
    • dvrkgrmgqjlnpc-nidyupdjsa-n
  • molecular-weight:
    • 749.036

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality