Difference between revisions of "SJ04674"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORYL-CHOLINE PHOSPHORYL-CHOLINE] == * common-name: ** phosphocholine * smiles: ** c[n+](c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8490 CPD-8490] == * common-name: ** decanal * smiles: ** ccccccccc[ch]=o * inchi-key: ** ks...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORYL-CHOLINE PHOSPHORYL-CHOLINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8490 CPD-8490] ==
 
* common-name:
 
* common-name:
** phosphocholine
+
** decanal
 
* smiles:
 
* smiles:
** c[n+](ccop([o-])([o-])=o)(c)c
+
** ccccccccc[ch]=o
 
* inchi-key:
 
* inchi-key:
** yhhsonzfoiemcp-uhfffaoysa-m
+
** ksmvzqyavgtkiv-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 182.136
+
** 156.267
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.7.15-RXN]]
+
* [[RXN-16653]]
* [[CHLPCTDh]]
 
* [[RXN-5647]]
 
* [[RXN-9614]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CHOLINE-KINASE-RXN]]
 
* [[PHOSPHOLIPASE-C-RXN]]
 
* [[RXN-15212]]
 
* [[RXN-9614]]
 
* [[SPHINGOMYELIN-PHOSPHODIESTERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phosphocholine}}
+
{{#set: common-name=decanal}}
{{#set: inchi-key=inchikey=yhhsonzfoiemcp-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=ksmvzqyavgtkiv-uhfffaoysa-n}}
{{#set: molecular-weight=182.136}}
+
{{#set: molecular-weight=156.267}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-8490

  • common-name:
    • decanal
  • smiles:
    • ccccccccc[ch]=o
  • inchi-key:
    • ksmvzqyavgtkiv-uhfffaoysa-n
  • molecular-weight:
    • 156.267

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality