Difference between revisions of "SJ04694"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-pseudouridine-38-40 tRNA-pseudouridine-38-40] == * common-name: ** a pseudouridine38-40 in...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12173 CPD-12173] == * common-name: ** (s)-3-hydroxy-isobutanoyl-coa * smiles: ** cc(c(=o)sc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-pseudouridine-38-40 tRNA-pseudouridine-38-40] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12173 CPD-12173] ==
 
* common-name:
 
* common-name:
** a pseudouridine38-40 in trna
+
** (s)-3-hydroxy-isobutanoyl-coa
 +
* smiles:
 +
** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])co
 +
* inchi-key:
 +
** wweogfzefhpuam-uqcjfraesa-j
 +
* molecular-weight:
 +
** 849.593
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3-HYDROXYISOBUTYRYL-COA-HYDROLASE-RXN]]
 +
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]]
+
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a pseudouridine38-40 in trna}}
+
{{#set: common-name=(s)-3-hydroxy-isobutanoyl-coa}}
 +
{{#set: inchi-key=inchikey=wweogfzefhpuam-uqcjfraesa-j}}
 +
{{#set: molecular-weight=849.593}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-12173

  • common-name:
    • (s)-3-hydroxy-isobutanoyl-coa
  • smiles:
    • cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])co
  • inchi-key:
    • wweogfzefhpuam-uqcjfraesa-j
  • molecular-weight:
    • 849.593

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality