Difference between revisions of "SJ04715"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-GLU ACETYL-GLU] == * common-name: ** n-acetyl-l-glutamate * smiles: ** cc(=o)nc(c([o-])=...")
(Created page with "Category:gene == Gene SJ04715 == * transcription-direction: ** negative * right-end-position: ** 113941 * left-end-position: ** 108336 * centisome-position: ** 21.405201...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-GLU ACETYL-GLU] ==
+
== Gene SJ04715 ==
−
* common-name:
+
* transcription-direction:
−
** n-acetyl-l-glutamate
+
** negative
−
* smiles:
+
* right-end-position:
−
** cc(=o)nc(c([o-])=o)ccc(=o)[o-]
+
** 113941
−
* inchi-key:
+
* left-end-position:
−
** rfmmmvdnipukgg-yfkpbyrvsa-l
+
** 108336
−
* molecular-weight:
+
* centisome-position:
−
** 187.152
+
** 21.405201   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[ACETYLGLUTKIN-RXN]]
+
* [[S.japonica_carotenoid_curated]]
−
* [[AGK]]
+
== Reaction(s) associated ==
−
* [[N-ACETYLTRANSFER-RXN]]
+
* [[RXN-11354]]
−
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
−
* [[ACETYLGLUTKIN-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
+
== Pathway(s) associated ==
−
* [[N-ACETYLTRANSFER-RXN]]
+
* [[PWY-6475]]
−
== Reaction(s) of unknown directionality ==
+
** '''8''' reactions found over '''8''' reactions in the full pathway
−
{{#set: common-name=n-acetyl-l-glutamate}}
+
{{#set: transcription-direction=negative}}
−
{{#set: inchi-key=inchikey=rfmmmvdnipukgg-yfkpbyrvsa-l}}
+
{{#set: right-end-position=113941}}
−
{{#set: molecular-weight=187.152}}
+
{{#set: left-end-position=108336}}
 +
{{#set: centisome-position=21.405201    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:04, 18 March 2021

Gene SJ04715

  • transcription-direction:
    • negative
  • right-end-position:
    • 113941
  • left-end-position:
    • 108336
  • centisome-position:
    • 21.405201

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6475
    • 8 reactions found over 8 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ04715&oldid=133304"