Difference between revisions of "SJ04718"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15364 CPD-15364] == * common-name: ** ricinoleoyl-coa * smiles: ** ccccccc(o)cc=ccccccccc(s...")
(Created page with "Category:gene == Gene SJ04718 == * transcription-direction: ** negative * right-end-position: ** 156302 * left-end-position: ** 142015 * centisome-position: ** 28.059551...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15364 CPD-15364] ==
+
== Gene SJ04718 ==
* common-name:
+
* transcription-direction:
** ricinoleoyl-coa
+
** negative
* smiles:
+
* right-end-position:
** ccccccc(o)cc=ccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** 156302
* inchi-key:
+
* left-end-position:
** bhvzcckrrpyxcv-mgnvxpimsa-j
+
** 142015
* molecular-weight:
+
* centisome-position:
** 1043.952
+
** 28.059551   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-14492]]
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-16151]]
+
== Reaction(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[MRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]]
* [[RXN-16151]]
+
** Category: [[annotation]]
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: common-name=ricinoleoyl-coa}}
+
== Pathway(s) associated ==
{{#set: inchi-key=inchikey=bhvzcckrrpyxcv-mgnvxpimsa-j}}
+
* [[PWY-7375]]
{{#set: molecular-weight=1043.952}}
+
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=156302}}
 +
{{#set: left-end-position=142015}}
 +
{{#set: centisome-position=28.059551    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:00, 18 March 2021

Gene SJ04718

  • transcription-direction:
    • negative
  • right-end-position:
    • 156302
  • left-end-position:
    • 142015
  • centisome-position:
    • 28.059551

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7375
    • 3 reactions found over 3 reactions in the full pathway