Difference between revisions of "SJ04783"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XTP XTP] == * common-name: ** xtp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9406 CPD-9406] == * common-name: ** (2s)-ethylmalonyl-coa * smiles: ** ccc(c(sccnc(=o)ccnc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XTP XTP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9406 CPD-9406] ==
 
* common-name:
 
* common-name:
** xtp
+
** (2s)-ethylmalonyl-coa
 
* smiles:
 
* smiles:
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23)))
+
** ccc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c([o-])=o
 
* inchi-key:
 
* inchi-key:
** caefewvyezabla-uuokfmhzsa-j
+
** vugzqvcbbbezqe-uqcjfraesa-i
 
* molecular-weight:
 
* molecular-weight:
** 520.136
+
** 876.595
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[NTPD]]
+
* [[RXN-13029]]
* [[RXN0-1603]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13029]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=xtp}}
+
{{#set: common-name=(2s)-ethylmalonyl-coa}}
{{#set: inchi-key=inchikey=caefewvyezabla-uuokfmhzsa-j}}
+
{{#set: inchi-key=inchikey=vugzqvcbbbezqe-uqcjfraesa-i}}
{{#set: molecular-weight=520.136}}
+
{{#set: molecular-weight=876.595}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-9406

  • common-name:
    • (2s)-ethylmalonyl-coa
  • smiles:
    • ccc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c([o-])=o
  • inchi-key:
    • vugzqvcbbbezqe-uqcjfraesa-i
  • molecular-weight:
    • 876.595

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality