Difference between revisions of "SJ04903"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ09107 == * transcription-direction: ** positive * right-end-position: ** 12586 * left-end-position: ** 3731 * centisome-position: ** 8.2931385...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-PHOSPHO-L-HOMOSERINE O-PHOSPHO-L-HOMOSERINE] == * common-name: ** o-phospho-l-homoserine * sm...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ09107 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-PHOSPHO-L-HOMOSERINE O-PHOSPHO-L-HOMOSERINE] ==
* transcription-direction:
+
* common-name:
** positive
+
** o-phospho-l-homoserine
* right-end-position:
+
* smiles:
** 12586
+
** c(cop([o-])(=o)[o-])c([n+])c([o-])=o
* left-end-position:
+
* inchi-key:
** 3731
+
** fxdnyoanaxwzhg-vkhmyheasa-l
* centisome-position:
+
* molecular-weight:
** 8.2931385   
+
** 197.084
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[CYSPH-RXN]]
== Reaction(s) associated ==
+
* [[RXN-12728]]
* [[1.18.1.2-RXN]]
+
* [[THRESYN-RXN]]
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[HOMOSERKIN-RXN]]
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=o-phospho-l-homoserine}}
* [[FLAVONADPREDUCT-RXN]]
+
{{#set: inchi-key=inchikey=fxdnyoanaxwzhg-vkhmyheasa-l}}
** Category: [[orthology]]
+
{{#set: molecular-weight=197.084}}
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN-17897]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY-101]]
 
** '''2''' reactions found over '''4''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=12586}}
 
{{#set: left-end-position=3731}}
 
{{#set: centisome-position=8.2931385    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=3}}
 
{{#set: nb pathway associated=1}}
 

Revision as of 09:25, 27 August 2019

Metabolite O-PHOSPHO-L-HOMOSERINE

  • common-name:
    • o-phospho-l-homoserine
  • smiles:
    • c(cop([o-])(=o)[o-])c([n+])c([o-])=o
  • inchi-key:
    • fxdnyoanaxwzhg-vkhmyheasa-l
  • molecular-weight:
    • 197.084

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality