Difference between revisions of "SJ04955"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=APS APS] == * common-name: ** adenosine 5'-phosphosulfate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=n...")
(Created page with "Category:gene == Gene SJ05166 == * transcription-direction: ** positive * right-end-position: ** 95968 * left-end-position: ** 84646 * centisome-position: ** 87.88272...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=APS APS] ==
+
== Gene SJ05166 ==
−
* common-name:
+
* transcription-direction:
−
** adenosine 5'-phosphosulfate
+
** positive
−
* smiles:
+
* right-end-position:
−
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(os(=o)([o-])=o)([o-])=o
+
** 95968
−
* inchi-key:
+
* left-end-position:
−
** irlpacmltupbcl-kqynxxcusa-l
+
** 84646
−
* molecular-weight:
+
* centisome-position:
−
** 425.266
+
** 87.88272   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[1.8.4.9-RXN]]
+
* [[S.japonica_sterols_curated]]
−
* [[ADENYLYLSULFATASE-RXN]]
+
== Reaction(s) associated ==
−
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
+
* [[RXN-15559]]
−
* [[ADENYLYLSULFKIN-RXN]]
+
** Category: [[annotation]]
−
* [[R163-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN-12019]]
+
* [[RXN-15560]]
−
* [[SULFATE-ADENYLYLTRANS-RXN]]
+
** Category: [[annotation]]
−
* [[SULFATE-ADENYLYLTRANSFERASE-ADP-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
== Reaction(s) known to produce the compound ==
+
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
−
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
+
** Category: [[annotation]]
−
* [[ADENYLYLSULFKIN-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[R163-RXN]]
+
== Pathway(s) associated ==
−
* [[SULFATE-ADENYLYLTRANS-RXN]]
+
* [[PWY-7511]]
−
== Reaction(s) of unknown directionality ==
+
** '''7''' reactions found over '''9''' reactions in the full pathway
−
{{#set: common-name=adenosine 5'-phosphosulfate}}
+
{{#set: transcription-direction=positive}}
−
{{#set: inchi-key=inchikey=irlpacmltupbcl-kqynxxcusa-l}}
+
{{#set: right-end-position=95968}}
−
{{#set: molecular-weight=425.266}}
+
{{#set: left-end-position=84646}}
 +
{{#set: centisome-position=87.88272    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=3}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:21, 18 December 2020

Gene SJ05166

  • transcription-direction:
    • positive
  • right-end-position:
    • 95968
  • left-end-position:
    • 84646
  • centisome-position:
    • 87.88272

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7511
    • 7 reactions found over 9 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ04955&oldid=41402"