Difference between revisions of "SJ04970"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRO-NEO-PTERIN DIHYDRO-NEO-PTERIN] == * common-name: ** 7,8-dihydroneopterin * smiles: ** c...")
(Created page with "Category:gene == Gene SJ04970 == * transcription-direction: ** negative * right-end-position: ** 442527 * left-end-position: ** 425133 * centisome-position: ** 44.02631...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRO-NEO-PTERIN DIHYDRO-NEO-PTERIN] ==
+
== Gene SJ04970 ==
* common-name:
+
* transcription-direction:
** 7,8-dihydroneopterin
+
** negative
* smiles:
+
* right-end-position:
** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2))
+
** 442527
* inchi-key:
+
* left-end-position:
** yqifamynggotfb-xinawcovsa-n
+
** 425133
* molecular-weight:
+
* centisome-position:
** 255.233
+
** 44.02631   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[H2NEOPTERINALDOL-RXN]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]]
+
* [[2.4.1.223-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=7,8-dihydroneopterin}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=yqifamynggotfb-xinawcovsa-n}}
+
* [[HEPARITIN-SULFOTRANSFERASE-RXN]]
{{#set: molecular-weight=255.233}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-6558]]
 +
** '''7''' reactions found over '''13''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=442527}}
 +
{{#set: left-end-position=425133}}
 +
{{#set: centisome-position=44.02631    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:03, 18 March 2021

Gene SJ04970

  • transcription-direction:
    • negative
  • right-end-position:
    • 442527
  • left-end-position:
    • 425133
  • centisome-position:
    • 44.02631

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6558
    • 7 reactions found over 13 reactions in the full pathway