Difference between revisions of "SJ04981"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR] == * common-name: ** 2,5...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-ALANINE D-ALANINE] == * common-name: ** d-alanine * smiles: ** cc([n+])c([o-])=o * inchi-key:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-ALANINE D-ALANINE] ==
 
* common-name:
 
* common-name:
** 2,5-diamino-6-(5-phospho-d-ribosylamino)pyrimidin-4(3h)-one
+
** d-alanine
 
* smiles:
 
* smiles:
** c(c2(c(o)c(o)c(nc1(=c(n)c(=o)nc(=n1)n))o2))op(=o)([o-])[o-]
+
** cc([n+])c([o-])=o
 
* inchi-key:
 
* inchi-key:
** oclclrxknjcojd-ummcilcdsa-l
+
** qnaybmklocpygj-uwtatzphsa-n
 
* molecular-weight:
 
* molecular-weight:
** 351.212
+
** 89.094
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RIBOFLAVINSYNDEAM-RXN]]
+
* [[D-ALANINE-AMINOTRANSFERASE-RXN]]
* [[RXN-10057]]
+
* [[DALADALALIG-RXN]]
* [[RXN-14171]]
+
* [[RXN-8672]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GTP-CYCLOHYDRO-II-RXN]]
+
* [[D-ALANINE-AMINOTRANSFERASE-RXN]]
* [[RXN-14171]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2,5-diamino-6-(5-phospho-d-ribosylamino)pyrimidin-4(3h)-one}}
+
{{#set: common-name=d-alanine}}
{{#set: inchi-key=inchikey=oclclrxknjcojd-ummcilcdsa-l}}
+
{{#set: inchi-key=inchikey=qnaybmklocpygj-uwtatzphsa-n}}
{{#set: molecular-weight=351.212}}
+
{{#set: molecular-weight=89.094}}

Revision as of 09:23, 27 August 2019

Metabolite D-ALANINE

  • common-name:
    • d-alanine
  • smiles:
    • cc([n+])c([o-])=o
  • inchi-key:
    • qnaybmklocpygj-uwtatzphsa-n
  • molecular-weight:
    • 89.094

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality