Difference between revisions of "SJ04983"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2472 == * common-name: ** (r)-nadhx * smiles: ** c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=...")
(Created page with "Category:metabolite == Metabolite 3-SULFINYL-PYRUVATE == * common-name: ** 3-sulfinopyruvate * smiles: ** c(s([o-])=o)c(=o)c(=o)[o-] * inchi-key: ** jxylqemxcaamol-uhfffao...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2472 ==
+
== Metabolite 3-SULFINYL-PYRUVATE ==
 
* common-name:
 
* common-name:
** (r)-nadhx
+
** 3-sulfinopyruvate
 
* smiles:
 
* smiles:
** c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c(n)=o)
+
** c(s([o-])=o)c(=o)c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** idbzkgqrlbfufq-mtkbybfrsa-l
+
** jxylqemxcaamol-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
** 681.445
+
** 150.106
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12752]]
+
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-nadhx}}
+
{{#set: common-name=3-sulfinopyruvate}}
{{#set: inchi-key=inchikey=idbzkgqrlbfufq-mtkbybfrsa-l}}
+
{{#set: inchi-key=inchikey=jxylqemxcaamol-uhfffaoysa-l}}
{{#set: molecular-weight=681.445}}
+
{{#set: molecular-weight=150.106}}

Revision as of 11:12, 15 January 2021

Metabolite 3-SULFINYL-PYRUVATE

  • common-name:
    • 3-sulfinopyruvate
  • smiles:
    • c(s([o-])=o)c(=o)c(=o)[o-]
  • inchi-key:
    • jxylqemxcaamol-uhfffaoysa-l
  • molecular-weight:
    • 150.106

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality