Difference between revisions of "SJ04983"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-SULFINYL-PYRUVATE == * common-name: ** 3-sulfinopyruvate * smiles: ** c(s([o-])=o)c(=o)c(=o)[o-] * inchi-key: ** jxylqemxcaamol-uhfffao...") |
(Created page with "Category:gene == Gene SJ04983 == * transcription-direction: ** negative * right-end-position: ** 646936 * left-end-position: ** 626201 * centisome-position: ** 64.848694...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:gene]] |
| − | == | + | == Gene SJ04983 == |
| − | * | + | * transcription-direction: |
| − | ** | + | ** negative |
| − | * | + | * right-end-position: |
| − | ** | + | ** 646936 |
| − | * | + | * left-end-position: |
| − | ** | + | ** 626201 |
| − | * | + | * centisome-position: |
| − | ** | + | ** 64.848694 |
| − | == | + | == Organism(s) associated with this gene == |
| − | * [[ | + | * [[S.japonica_carotenoid_curated]] |
| − | == Reaction(s) | + | == Reaction(s) associated == |
| − | * [[ | + | * [[PROTEIN-KINASE-RXN]] |
| − | == | + | ** Category: [[annotation]] |
| − | {{#set: | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
| − | {{#set: | + | * [[RXN-8443]] |
| − | {{#set: | + | ** Category: [[orthology]] |
| + | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | ||
| + | == Pathway(s) associated == | ||
| + | * [[PWY-5381]] | ||
| + | ** '''6''' reactions found over '''11''' reactions in the full pathway | ||
| + | {{#set: transcription-direction=negative}} | ||
| + | {{#set: right-end-position=646936}} | ||
| + | {{#set: left-end-position=626201}} | ||
| + | {{#set: centisome-position=64.848694 }} | ||
| + | {{#set: organism associated=S.japonica_carotenoid_curated}} | ||
| + | {{#set: nb reaction associated=2}} | ||
| + | {{#set: nb pathway associated=1}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Gene SJ04983
- transcription-direction:
- negative
- right-end-position:
- 646936
- left-end-position:
- 626201
- centisome-position:
- 64.848694
Organism(s) associated with this gene
Reaction(s) associated
- PROTEIN-KINASE-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- RXN-8443
- Category: orthology
- source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a
- Category: orthology
Pathway(s) associated
- PWY-5381
- 6 reactions found over 11 reactions in the full pathway
