Difference between revisions of "SJ04983"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19151 == * common-name: ** (s)-3-hydroxy-(5z)-dodecenoyl-coa * smiles: ** ccccccc=ccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(...")
(Created page with "Category:gene == Gene SJ04983 == * transcription-direction: ** negative * right-end-position: ** 646936 * left-end-position: ** 626201 * centisome-position: ** 64.848694...")
 
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite CPD-19151 ==
+
== Gene SJ04983 ==
* common-name:
+
* transcription-direction:
** (s)-3-hydroxy-(5z)-dodecenoyl-coa
+
** negative
* smiles:
+
* right-end-position:
** ccccccc=ccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 646936
* inchi-key:
+
* left-end-position:
** ayordfmyybnsbo-qccsjadrsa-j
+
** 626201
* molecular-weight:
+
* centisome-position:
** 959.791
+
** 64.848694   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-17798]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[RXN-17797]]
+
* [[PROTEIN-KINASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=(s)-3-hydroxy-(5z)-dodecenoyl-coa}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=ayordfmyybnsbo-qccsjadrsa-j}}
+
* [[RXN-8443]]
{{#set: molecular-weight=959.791}}
+
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-5381]]
 +
** '''6''' reactions found over '''11''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=646936}}
 +
{{#set: left-end-position=626201}}
 +
{{#set: centisome-position=64.848694    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:11, 18 March 2021

Gene SJ04983

  • transcription-direction:
    • negative
  • right-end-position:
    • 646936
  • left-end-position:
    • 626201
  • centisome-position:
    • 64.848694

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-5381
    • 6 reactions found over 11 reactions in the full pathway