Difference between revisions of "SJ04991"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-SUCCINYL-2-AMINO-6-KETOPIMELATE N-SUCCINYL-2-AMINO-6-KETOPIMELATE] == * common-name: ** n-suc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Proteins-L-Threonines Proteins-L-Threonines] == * common-name: ** a [protein]-l-threonine == Re...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-SUCCINYL-2-AMINO-6-KETOPIMELATE N-SUCCINYL-2-AMINO-6-KETOPIMELATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Proteins-L-Threonines Proteins-L-Threonines] ==
 
* common-name:
 
* common-name:
** n-succinyl-2-amino-6-ketopimelate
+
** a [protein]-l-threonine
* smiles:
 
** c(cc(=o)c(=o)[o-])cc(nc(ccc([o-])=o)=o)c([o-])=o
 
* inchi-key:
 
** sdvxscsnvvzwdd-lurjtmiesa-k
 
* molecular-weight:
 
** 286.218
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
+
* [[RXN-11890]]
 +
* [[RXN-14906]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
+
* [[RXN-11890]]
 +
* [[RXN-14906]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-succinyl-2-amino-6-ketopimelate}}
+
{{#set: common-name=a [protein]-l-threonine}}
{{#set: inchi-key=inchikey=sdvxscsnvvzwdd-lurjtmiesa-k}}
 
{{#set: molecular-weight=286.218}}
 

Revision as of 09:23, 27 August 2019

Metabolite Proteins-L-Threonines

  • common-name:
    • a [protein]-l-threonine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-l-threonine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.