Difference between revisions of "SJ05049"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-N-omega-dimethyl-arginine Protein-N-omega-dimethyl-arginine] == * common-name: ** [prot...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-308 CPD-308] == * common-name: ** d-nopaline * smiles: ** c([o-])(=o)ccc([n+]c(c(=o)[o-])cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-308 CPD-308] == |
* common-name: | * common-name: | ||
| − | ** [ | + | ** d-nopaline |
| + | * smiles: | ||
| + | ** c([o-])(=o)ccc([n+]c(c(=o)[o-])cccnc(n)=[n+])c([o-])=o | ||
| + | * inchi-key: | ||
| + | ** lmkyzbgvkhtltn-nkwvepmbsa-m | ||
| + | * molecular-weight: | ||
| + | ** 303.294 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[1.5.1.19-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-nopaline}} |
| + | {{#set: inchi-key=inchikey=lmkyzbgvkhtltn-nkwvepmbsa-m}} | ||
| + | {{#set: molecular-weight=303.294}} | ||
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-308
- common-name:
- d-nopaline
- smiles:
- c([o-])(=o)ccc([n+]c(c(=o)[o-])cccnc(n)=[n+])c([o-])=o
- inchi-key:
- lmkyzbgvkhtltn-nkwvepmbsa-m
- molecular-weight:
- 303.294
