Difference between revisions of "SJ05163"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8082 CPD-8082] == * common-name: ** 1-18:2-2-18:2-digalactosyldiacylglycerol * smiles: ** c...")
 
(Created page with "Category:gene == Gene SJ05163 == * transcription-direction: ** negative * right-end-position: ** 57053 * left-end-position: ** 38739 * centisome-position: ** 40.220314...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8082 CPD-8082] ==
+
== Gene SJ05163 ==
−
* common-name:
+
* transcription-direction:
−
** 1-18:2-2-18:2-digalactosyldiacylglycerol
+
** negative
−
* smiles:
+
* right-end-position:
−
** cccccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=cccccc)=o
+
** 57053
−
* inchi-key:
+
* left-end-position:
−
** muubilnsvlplll-mezujybgsa-n
+
** 38739
−
* molecular-weight:
+
* centisome-position:
−
** 941.247
+
** 40.220314   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-8310]]
+
* [[S.japonica_carotenoid_curated]]
−
* [[RXN-8313]]
+
== Reaction(s) associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-10036]]
−
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
−
{{#set: common-name=1-18:2-2-18:2-digalactosyldiacylglycerol}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: inchi-key=inchikey=muubilnsvlplll-mezujybgsa-n}}
+
== Pathway(s) associated ==
−
{{#set: molecular-weight=941.247}}
+
* [[PWY-6368]]
 +
** '''6''' reactions found over '''9''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=57053}}
 +
{{#set: left-end-position=38739}}
 +
{{#set: centisome-position=40.220314    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:02, 18 March 2021

Gene SJ05163

  • transcription-direction:
    • negative
  • right-end-position:
    • 57053
  • left-end-position:
    • 38739
  • centisome-position:
    • 40.220314

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6368
    • 6 reactions found over 9 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ05163&oldid=132448"