Difference between revisions of "SJ05174"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-558 CPD-558] == * common-name: ** pimeloyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-1-PHENYLETHANOL S-1-PHENYLETHANOL] == * common-name: ** (s)-1-phenylethanol * smiles: ** cc(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-558 CPD-558] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-1-PHENYLETHANOL S-1-PHENYLETHANOL] ==
 
* common-name:
 
* common-name:
** pimeloyl-coa
+
** (s)-1-phenylethanol
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cccccc([o-])=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(o)c1(c=cc=cc=1)
 
* inchi-key:
 
* inchi-key:
** lycrxmtyuzduga-uyrkptjqsa-i
+
** wapnohkvxsqrpx-zetcqymhsa-n
 
* molecular-weight:
 
* molecular-weight:
** 904.649
+
** 122.166
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[7KAPSYN-RXN]]
+
* [[RXN-1302]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-1302]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pimeloyl-coa}}
+
{{#set: common-name=(s)-1-phenylethanol}}
{{#set: inchi-key=inchikey=lycrxmtyuzduga-uyrkptjqsa-i}}
+
{{#set: inchi-key=inchikey=wapnohkvxsqrpx-zetcqymhsa-n}}
{{#set: molecular-weight=904.649}}
+
{{#set: molecular-weight=122.166}}

Revision as of 14:20, 26 August 2019

Metabolite S-1-PHENYLETHANOL

  • common-name:
    • (s)-1-phenylethanol
  • smiles:
    • cc(o)c1(c=cc=cc=1)
  • inchi-key:
    • wapnohkvxsqrpx-zetcqymhsa-n
  • molecular-weight:
    • 122.166

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality