Difference between revisions of "SJ05174"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-1-PHENYLETHANOL S-1-PHENYLETHANOL] == * common-name: ** (s)-1-phenylethanol * smiles: ** cc(o...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PSEUDOURIDINE-5-P PSEUDOURIDINE-5-P] == * common-name: ** pseudouridine 5'-phosphate * smiles:...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PSEUDOURIDINE-5-P PSEUDOURIDINE-5-P] == |
* common-name: | * common-name: | ||
− | ** | + | ** pseudouridine 5'-phosphate |
* smiles: | * smiles: | ||
− | ** | + | ** c1(nc(=o)nc(=o)c=1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2)) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** mobmojgxnhllir-gbndhiklsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 322.168 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-15703]] |
+ | * [[RXN0-5398]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[PSEUDOURIDINE-KINASE-RXN]] |
+ | * [[RXN-15703]] | ||
+ | * [[RXN0-5398]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=pseudouridine 5'-phosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mobmojgxnhllir-gbndhiklsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=322.168}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite PSEUDOURIDINE-5-P
- common-name:
- pseudouridine 5'-phosphate
- smiles:
- c1(nc(=o)nc(=o)c=1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2))
- inchi-key:
- mobmojgxnhllir-gbndhiklsa-l
- molecular-weight:
- 322.168