Difference between revisions of "SJ05182"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CAAX-proteins CAAX-proteins] == * common-name: ** a protein that ends with a caax sequence == R...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10814 CPD-10814] == * common-name: ** glycyl-l-proline * smiles: ** c1(n(c(=o)c[n+])c(cc1)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CAAX-proteins CAAX-proteins] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10814 CPD-10814] ==
 
* common-name:
 
* common-name:
** a protein that ends with a caax sequence
+
** glycyl-l-proline
 +
* smiles:
 +
** c1(n(c(=o)c[n+])c(cc1)c(=o)[o-])
 +
* inchi-key:
 +
** kznqnbzmbzjqjo-yfkpbyrvsa-n
 +
* molecular-weight:
 +
** 172.183
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17573]]
+
* [[RXN0-6988]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a protein that ends with a caax sequence}}
+
{{#set: common-name=glycyl-l-proline}}
 +
{{#set: inchi-key=inchikey=kznqnbzmbzjqjo-yfkpbyrvsa-n}}
 +
{{#set: molecular-weight=172.183}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-10814

  • common-name:
    • glycyl-l-proline
  • smiles:
    • c1(n(c(=o)c[n+])c(cc1)c(=o)[o-])
  • inchi-key:
    • kznqnbzmbzjqjo-yfkpbyrvsa-n
  • molecular-weight:
    • 172.183

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality