Difference between revisions of "SJ05196"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ALPHA-ACETYLORNITHINE N-ALPHA-ACETYLORNITHINE] == * common-name: ** n-acetyl-l-ornithine * sm...")
(Created page with "Category:gene == Gene SJ05196 == * transcription-direction: ** positive * right-end-position: ** 254087 * left-end-position: ** 235590 * centisome-position: ** 47.066322...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ALPHA-ACETYLORNITHINE N-ALPHA-ACETYLORNITHINE] ==
+
== Gene SJ05196 ==
−
* common-name:
+
* transcription-direction:
−
** n-acetyl-l-ornithine
+
** positive
−
* smiles:
+
* right-end-position:
−
** cc(=o)nc(ccc[n+])c(=o)[o-]
+
** 254087
−
* inchi-key:
+
* left-end-position:
−
** jrlgpaxaghmnol-lurjtmiesa-n
+
** 235590
−
* molecular-weight:
+
* centisome-position:
−
** 174.199
+
** 47.066322   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[ACETYLORNDEACET-RXN]]
+
* [[S.japonica_carotenoid_curated]]
−
* [[ACETYLORNTRANSAM-RXN]]
+
== Reaction(s) associated ==
−
* [[AODAA]]
+
* [[RXN-9839]]
−
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
+
** Category: [[annotation]]
−
== Reaction(s) known to produce the compound ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[ACETYLORNDEACET-RXN]]
+
== Pathway(s) associated ==
−
* [[ACETYLORNTRANSAM-RXN]]
+
* [[PWY-6082]]
−
== Reaction(s) of unknown directionality ==
+
** '''3''' reactions found over '''7''' reactions in the full pathway
−
{{#set: common-name=n-acetyl-l-ornithine}}
+
* [[PWY-6073]]
−
{{#set: inchi-key=inchikey=jrlgpaxaghmnol-lurjtmiesa-n}}
+
** '''3''' reactions found over '''3''' reactions in the full pathway
−
{{#set: molecular-weight=174.199}}
+
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=254087}}
 +
{{#set: left-end-position=235590}}
 +
{{#set: centisome-position=47.066322    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=2}}

Latest revision as of 11:04, 18 March 2021

Gene SJ05196

  • transcription-direction:
    • positive
  • right-end-position:
    • 254087
  • left-end-position:
    • 235590
  • centisome-position:
    • 47.066322

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6082
    • 3 reactions found over 7 reactions in the full pathway
  • PWY-6073
    • 3 reactions found over 3 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ05196&oldid=133453"