Difference between revisions of "SJ05236"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Tubulin-Heterodimers Tubulin-Heterodimers] == * common-name: ** an α/β tubulin heter...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15684 CPD-15684] == * common-name: ** 5-cis, 7-trans-tetradecadienoyl-coa * smiles: ** cccc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15684 CPD-15684] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-cis, 7-trans-tetradecadienoyl-coa |
| + | * smiles: | ||
| + | ** ccccccc=cc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
| + | * inchi-key: | ||
| + | ** amanzgdvbadzlh-qtjplklfsa-j | ||
| + | * molecular-weight: | ||
| + | ** 969.83 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-14796]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-cis, 7-trans-tetradecadienoyl-coa}} |
| + | {{#set: inchi-key=inchikey=amanzgdvbadzlh-qtjplklfsa-j}} | ||
| + | {{#set: molecular-weight=969.83}} | ||
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-15684
- common-name:
- 5-cis, 7-trans-tetradecadienoyl-coa
- smiles:
- ccccccc=cc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- amanzgdvbadzlh-qtjplklfsa-j
- molecular-weight:
- 969.83
