Difference between revisions of "SJ05242"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHORISMATE CHORISMATE] == * common-name: ** chorismate * smiles: ** c=c(c(=o)[o-])oc1(c(o)c=cc(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-ILE-tRNAs Charged-ILE-tRNAs] == * common-name: ** an l-isoleucyl-[trnaile] == Reaction(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHORISMATE CHORISMATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-ILE-tRNAs Charged-ILE-tRNAs] ==
 
* common-name:
 
* common-name:
** chorismate
+
** an l-isoleucyl-[trnaile]
* smiles:
 
** c=c(c(=o)[o-])oc1(c(o)c=cc(c([o-])=o)=c1)
 
* inchi-key:
 
** wtfxtqvdakgdey-htqzyqbosa-l
 
* molecular-weight:
 
** 224.17
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ANTHRANSYN-RXN]]
 
* [[CHORISMATEMUT-RXN]]
 
* [[ISOCHORSYN-RXN]]
 
* [[PABASYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ANTHRANSYN-RXN]]
+
* [[ISOLEUCINE--TRNA-LIGASE-RXN]]
* [[CHORISMATE-SYNTHASE-RXN]]
 
* [[CHORISMATEMUT-RXN]]
 
* [[ISOCHORSYN-RXN]]
 
* [[PABASYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=chorismate}}
+
{{#set: common-name=an l-isoleucyl-[trnaile]}}
{{#set: inchi-key=inchikey=wtfxtqvdakgdey-htqzyqbosa-l}}
 
{{#set: molecular-weight=224.17}}
 

Revision as of 09:24, 27 August 2019

Metabolite Charged-ILE-tRNAs

  • common-name:
    • an l-isoleucyl-[trnaile]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-isoleucyl-[trnaile" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.