Difference between revisions of "SJ05251"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-30 CPDQT-30] == * common-name: ** 9-(methylthio)-2-oxononanoate * smiles: ** cscccccccc(=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-206 CPD-206] == * common-name: ** phytanoyl-coa * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)cc(s...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-30 CPDQT-30] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-206 CPD-206] ==
 
* common-name:
 
* common-name:
** 9-(methylthio)-2-oxononanoate
+
** phytanoyl-coa
 
* smiles:
 
* smiles:
** cscccccccc(=o)c([o-])=o
+
** cc(c)cccc(c)cccc(c)cccc(c)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
* inchi-key:
** mjgxiouqxyxglp-uhfffaoysa-m
+
** nrjqghhzmsouen-hhvnvsiesa-j
 
* molecular-weight:
 
* molecular-weight:
** 217.302
+
** 1058.022
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1.14.11.18-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXNQT-4174]]
+
* [[RXN66-482]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=9-(methylthio)-2-oxononanoate}}
+
{{#set: common-name=phytanoyl-coa}}
{{#set: inchi-key=inchikey=mjgxiouqxyxglp-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=nrjqghhzmsouen-hhvnvsiesa-j}}
{{#set: molecular-weight=217.302}}
+
{{#set: molecular-weight=1058.022}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-206

  • common-name:
    • phytanoyl-coa
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • nrjqghhzmsouen-hhvnvsiesa-j
  • molecular-weight:
    • 1058.022

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality