Difference between revisions of "SJ05257"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPALDEHYDE SINAPALDEHYDE] == * common-name: ** sinapaldehyde * smiles: ** coc1(c=c(c=cc=o)c=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-pseudouridine32 tRNA-pseudouridine32] == * common-name: ** a pseudouridine32 in trna == Re...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPALDEHYDE SINAPALDEHYDE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-pseudouridine32 tRNA-pseudouridine32] ==
 
* common-name:
 
* common-name:
** sinapaldehyde
+
** a pseudouridine32 in trna
* smiles:
 
** coc1(c=c(c=cc=o)c=c(oc)c(o)=1)
 
* inchi-key:
 
** cdicdsogtrchmg-onegzznksa-n
 
* molecular-weight:
 
** 208.213
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-1124]]
 
* [[RXN-1125]]
 
* [[RXN-8014]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1124]]
+
* [[RXN-11842]]
* [[RXN-1143]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=sinapaldehyde}}
+
{{#set: common-name=a pseudouridine32 in trna}}
{{#set: inchi-key=inchikey=cdicdsogtrchmg-onegzznksa-n}}
 
{{#set: molecular-weight=208.213}}
 

Revision as of 14:19, 26 August 2019

Metabolite tRNA-pseudouridine32

  • common-name:
    • a pseudouridine32 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality