Difference between revisions of "SJ05258"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-COA MALONYL-COA] == * common-name: ** malonyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)n...")
 
(Created page with "Category:gene == Gene SJ05258 == * transcription-direction: ** negative * right-end-position: ** 481707 * left-end-position: ** 469958 * centisome-position: ** 94.21734...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-COA MALONYL-COA] ==
+
== Gene SJ05258 ==
−
* common-name:
+
* transcription-direction:
−
** malonyl-coa
+
** negative
−
* smiles:
+
* right-end-position:
−
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 481707
−
* inchi-key:
+
* left-end-position:
−
** ltyoqgrjfjakna-dvvlenmvsa-i
+
** 469958
−
* molecular-weight:
+
* centisome-position:
−
** 848.541
+
** 94.21734   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
 +
* [[S.japonica_carotenoid_curated]]
 +
== Reaction(s) associated ==
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
* [[ACOACXr]]
+
* [[2.4.1.67-RXN]]
−
* [[FATTY-ACID-SYNTHASE-RXN]]
+
** Category: [[orthology]]
−
* [[MALONYL-COA-ACP-TRANSACYL-RXN]]
+
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
−
* [[MALONYL-COA-DECARBOXYLASE-RXN]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
+
* [[2.4.1.82-RXN]]
−
* [[RXN-10059]]
+
** Category: [[annotation]]
−
* [[RXN-10734]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN-12777]]
+
* [[ALPHAGALACTOSID-RXN]]
−
* [[RXN-13294]]
+
** Category: [[annotation]]
−
* [[RXN-13295]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN-13296]]
+
** Category: [[orthology]]
−
* [[RXN-13297]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
* [[RXN-13322]]
+
* [[RXN-11501]]
−
* [[RXN-13431]]
+
** Category: [[annotation]]
−
* [[RXN-13441]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN-14492]]
+
** Category: [[orthology]]
−
* [[RXN-16016]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
* [[RXN-16017]]
+
* [[RXN-11502]]
−
* [[RXN-16094]]
+
** Category: [[annotation]]
−
* [[RXN-16153]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN-3142]]
+
* [[RXN-12088]]
−
* [[RXN-7645]]
+
** Category: [[annotation]]
−
* [[RXN-7697]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN-9543]]
+
** Category: [[orthology]]
−
* [[RXN-9632]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
* [[RXN-9648]]
+
* [[RXN-17830]]
−
* [[RXN-9650]]
+
** Category: [[annotation]]
−
* [[RXN-9651]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN-9652]]
 
−
* [[RXN-9653]]
 
−
* [[RXN-9654]]
 
−
* [[RXN1G-368]]
 
−
* [[RXN1G-445]]
 
−
* [[RXN1G-499]]
 
 
</div>
 
</div>
−
== Reaction(s) known to produce the compound ==
+
== Pathway(s) associated ==
−
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
+
* [[PWY-5337]]
−
* [[RXN0-5055]]
+
** '''3''' reactions found over '''3''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[PWY-6524]]
−
{{#set: common-name=malonyl-coa}}
+
** '''2''' reactions found over '''4''' reactions in the full pathway
−
{{#set: inchi-key=inchikey=ltyoqgrjfjakna-dvvlenmvsa-i}}
+
* [[PWY-6525]]
−
{{#set: molecular-weight=848.541}}
+
** '''2''' reactions found over '''5''' reactions in the full pathway
 +
* [[PWY0-1301]]
 +
** '''1''' reactions found over '''1''' reactions in the full pathway
 +
* [[PWY-6527]]
 +
** '''7''' reactions found over '''7''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=481707}}
 +
{{#set: left-end-position=469958}}
 +
{{#set: centisome-position=94.21734    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=7}}
 +
{{#set: nb pathway associated=5}}

Latest revision as of 11:01, 18 March 2021

Gene SJ05258

  • transcription-direction:
    • negative
  • right-end-position:
    • 481707
  • left-end-position:
    • 469958
  • centisome-position:
    • 94.21734

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-5337
    • 3 reactions found over 3 reactions in the full pathway
  • PWY-6524
    • 2 reactions found over 4 reactions in the full pathway
  • PWY-6525
    • 2 reactions found over 5 reactions in the full pathway
  • PWY0-1301
    • 1 reactions found over 1 reactions in the full pathway
  • PWY-6527
    • 7 reactions found over 7 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ05258&oldid=132158"