Difference between revisions of "SJ05262"

Revision as of 09:23, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPOYL-COA SINAPOYL-COA] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Deamido-bleomycins Deamido-bleomycins] ==
 * common-name:
-** sinapoyl-coa
+** a deamido-bleomycin
-* smiles:
-** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=c(oc)c=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
-* inchi-key:
-** rbfuwesmwrugfy-gsnioflcsa-j
-* molecular-weight:
-** 969.7
 == Reaction(s) known to consume the compound ==
-* [[RXN-1124]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-10919]]
+* [[3.4.22.40-RXN]]
-* [[RXN-1124]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=sinapoyl-coa}}
+{{#set: common-name=a deamido-bleomycin}}
-{{#set: inchi-key=inchikey=rbfuwesmwrugfy-gsnioflcsa-j}}
-{{#set: molecular-weight=969.7}}