Difference between revisions of "SJ05263"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OLEATE-CPD OLEATE-CPD] == * common-name: ** oleate * smiles: ** ccccccccc=ccccccccc([o-])=o * i...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16825 CPD-16825] == * common-name: ** (s)-equol 4'-sulfate * smiles: ** c1(c=c(c=c2(occ(cc=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16825 CPD-16825] == |
* common-name: | * common-name: | ||
| − | ** | + | ** (s)-equol 4'-sulfate |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(c=c(c=c2(occ(cc=12)c3(c=cc(=cc=3)os([o-])(=o)=o)))o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** uxojwgsgkuymia-gfccvegcsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 321.324 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-15589]] | |
| − | * [[RXN- | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-15589]] | |
| − | * [[RXN- | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(s)-equol 4'-sulfate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uxojwgsgkuymia-gfccvegcsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=321.324}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-16825
- common-name:
- (s)-equol 4'-sulfate
- smiles:
- c1(c=c(c=c2(occ(cc=12)c3(c=cc(=cc=3)os([o-])(=o)=o)))o)
- inchi-key:
- uxojwgsgkuymia-gfccvegcsa-m
- molecular-weight:
- 321.324
