Difference between revisions of "SJ05273"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18494 CPD-18494] == * common-name: ** 3-oxo-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa * s...")
(Created page with "Category:gene == Gene SJ05273 == * transcription-direction: ** positive * right-end-position: ** 21771 * left-end-position: ** 4279 * centisome-position: ** 4.525887 =...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18494 CPD-18494] ==
+
== Gene SJ05273 ==
−
* common-name:
+
* transcription-direction:
−
** 3-oxo-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa
+
** positive
−
* smiles:
+
* right-end-position:
−
** cccccc=ccc=ccc=ccc=ccc=cccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** 21771
−
* inchi-key:
+
* left-end-position:
−
** uiagujimvqpsdp-qojzhlsosa-j
+
** 4279
−
* molecular-weight:
+
* centisome-position:
−
** 1118.034
+
** 4.525887   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-17116]]
+
* [[S.japonica_carotenoid_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
−
{{#set: common-name=3-oxo-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=uiagujimvqpsdp-qojzhlsosa-j}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=1118.034}}
+
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=21771}}
 +
{{#set: left-end-position=4279}}
 +
{{#set: centisome-position=4.525887    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:03, 18 March 2021

Gene SJ05273

  • transcription-direction:
    • positive
  • right-end-position:
    • 21771
  • left-end-position:
    • 4279
  • centisome-position:
    • 4.525887

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ05273&oldid=132921"