Difference between revisions of "SJ05312"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14275 CPD-14275] == * common-name: ** (3r)-3-hydroxy-arachidoyl-coa * smiles: ** cccccccccc...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7066 CPD-7066] == * common-name: ** (2r,3s)-3-methylmalate * smiles: ** cc(c(=o)[o-])c(o)c(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7066 CPD-7066] == |
* common-name: | * common-name: | ||
− | ** ( | + | ** (2r,3s)-3-methylmalate |
* smiles: | * smiles: | ||
− | ** | + | ** cc(c(=o)[o-])c(o)c([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** npyqjihhtgfbln-sthayslisa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 146.099 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-7745]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=( | + | {{#set: common-name=(2r,3s)-3-methylmalate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=npyqjihhtgfbln-sthayslisa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=146.099}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-7066
- common-name:
- (2r,3s)-3-methylmalate
- smiles:
- cc(c(=o)[o-])c(o)c([o-])=o
- inchi-key:
- npyqjihhtgfbln-sthayslisa-l
- molecular-weight:
- 146.099