Difference between revisions of "SJ05422"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-8-DIHYDROPTEROATE 7-8-DIHYDROPTEROATE] == * common-name: ** 7,8-dihydropteroate * smiles: **...")
 
(Created page with "Category:gene == Gene SJ05422 == * transcription-direction: ** positive * right-end-position: ** 14278 * left-end-position: ** 6487 * centisome-position: ** 1.3076704...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-8-DIHYDROPTEROATE 7-8-DIHYDROPTEROATE] ==
+
== Gene SJ05422 ==
* common-name:
+
* transcription-direction:
** 7,8-dihydropteroate
+
** positive
* smiles:
+
* right-end-position:
** c(nc1(=cc=c(c(=o)[o-])c=c1))c3(cnc2(=c(c(=o)nc(n)=n2)n=3))
+
** 14278
* inchi-key:
+
* left-end-position:
** wbfyvdchgvnrbh-uhfffaoysa-m
+
** 6487
* molecular-weight:
+
* centisome-position:
** 313.295
+
** 1.3076704   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[DIHYDROFOLATESYNTH-RXN]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[H2PTEROATESYNTH-RXN]]
+
* [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=7,8-dihydropteroate}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=wbfyvdchgvnrbh-uhfffaoysa-m}}
+
{{#set: transcription-direction=positive}}
{{#set: molecular-weight=313.295}}
+
{{#set: right-end-position=14278}}
 +
{{#set: left-end-position=6487}}
 +
{{#set: centisome-position=1.3076704    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:04, 18 March 2021

Gene SJ05422

  • transcription-direction:
    • positive
  • right-end-position:
    • 14278
  • left-end-position:
    • 6487
  • centisome-position:
    • 1.3076704

Organism(s) associated with this gene

Reaction(s) associated