Difference between revisions of "SJ05429"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4211 CPD-4211] == * common-name: ** dimethylallyl diphosphate * smiles: ** cc(c)=ccop(=o)([...")
(Created page with "Category:gene == Gene SJ05429 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * ACID-PHOSPHATASE-RXN *...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4211 CPD-4211] ==
+
== Gene SJ05429 ==
* common-name:
+
== Organism(s) associated with this gene  ==
** dimethylallyl diphosphate
+
* [[S.japonica_carotenoid_curated]]
* smiles:
+
== Reaction(s) associated ==
** cc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
+
* [[ACID-PHOSPHATASE-RXN]]
* inchi-key:
+
** Category: [[orthology]]
** cbidrcwhncksto-uhfffaoysa-k
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* molecular-weight:
+
* [[RXN-5822]]
** 243.069
+
** Category: [[orthology]]
== Reaction(s) known to consume the compound ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[GPPS]]
+
== Pathway(s) associated ==
* [[GPPSYN-RXN]]
+
* [[PWY-6348]]
* [[IPPISOM-RXN]]
+
** '''1''' reactions found over '''1''' reactions in the full pathway
* [[RXN-4303]]
+
* [[NADPHOS-DEPHOS-PWY]]
* [[RXN-4305]]
+
** '''3''' reactions found over '''3''' reactions in the full pathway
* [[RXN-4307]]
+
* [[PWY-5083]]
* [[RXN-7810]]
+
** '''5''' reactions found over '''6''' reactions in the full pathway
* [[RXN-7811]]
+
* [[NAD-BIOSYNTHESIS-II]]
* [[RXN-7813]]
+
** '''4''' reactions found over '''3''' reactions in the full pathway
* [[RXN0-6274]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction associated=2}}
* [[GPPSYN-RXN]]
+
{{#set: nb pathway associated=4}}
* [[IDI]]
 
* [[IDS2]]
 
* [[IPPISOM-RXN]]
 
* [[RXN0-884]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=dimethylallyl diphosphate}}
 
{{#set: inchi-key=inchikey=cbidrcwhncksto-uhfffaoysa-k}}
 
{{#set: molecular-weight=243.069}}
 

Latest revision as of 11:01, 18 March 2021

Gene SJ05429

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6348
    • 1 reactions found over 1 reactions in the full pathway
  • NADPHOS-DEPHOS-PWY
    • 3 reactions found over 3 reactions in the full pathway
  • PWY-5083
    • 5 reactions found over 6 reactions in the full pathway
  • NAD-BIOSYNTHESIS-II
    • 4 reactions found over 3 reactions in the full pathway