Difference between revisions of "SJ05429"

Revision as of 14:19, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15677 CPD-15677] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4211 CPD-4211] ==
 * common-name:
-** 4-trans-undecenoyl-coa
+** dimethylallyl diphosphate
 * smiles:
-** ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+** cc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
 * inchi-key:
-** afmmiiqkxqnedn-dupkwvsksa-j
+** cbidrcwhncksto-uhfffaoysa-k
 * molecular-weight:
-** 929.765
+** 243.069
 == Reaction(s) known to consume the compound ==
-* [[RXN-14789]]
+* [[GPPS]]
+* [[GPPSYN-RXN]]
+* [[IPPISOM-RXN]]
+* [[RXN-4303]]
+* [[RXN-4305]]
+* [[RXN-4307]]
+* [[RXN-7810]]
+* [[RXN-7811]]
+* [[RXN-7813]]
+* [[RXN0-6274]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-14788]]
+* [[GPPSYN-RXN]]
+* [[IDI]]
+* [[IDS2]]
+* [[IPPISOM-RXN]]
+* [[RXN0-884]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=4-trans-undecenoyl-coa}}
+{{#set: common-name=dimethylallyl diphosphate}}
-{{#set: inchi-key=inchikey=afmmiiqkxqnedn-dupkwvsksa-j}}
+{{#set: inchi-key=inchikey=cbidrcwhncksto-uhfffaoysa-k}}
-{{#set: molecular-weight=929.765}}
+{{#set: molecular-weight=243.069}}