Difference between revisions of "SJ05435"

Revision as of 14:20, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15189 CPD-15189] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPYL-ALCOHOL SINAPYL-ALCOHOL] ==
 * common-name:
-** chenodeoxycholate
+** sinapyl alcohol
 * smiles:
-** cc(ccc(=o)[o-])[ch]2(cc[ch]3([ch]4(c(o)c[ch]1(cc(o)ccc(c)1[ch](ccc(c)23)4))))
+** coc1(c=c(c=cco)c=c(oc)c(o)=1)
 * inchi-key:
-** rudatbohqwojdd-bswaidmhsa-m
+** lzfopexouvtgjs-onegzznksa-n
 * molecular-weight:
-** 391.57
+** 210.229
 == Reaction(s) known to consume the compound ==
-* [[RXN-16033]]
 == Reaction(s) known to produce the compound ==
+* [[RXN-1125]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=chenodeoxycholate}}
+{{#set: common-name=sinapyl alcohol}}
-{{#set: inchi-key=inchikey=rudatbohqwojdd-bswaidmhsa-m}}
+{{#set: inchi-key=inchikey=lzfopexouvtgjs-onegzznksa-n}}
-{{#set: molecular-weight=391.57}}
+{{#set: molecular-weight=210.229}}