Difference between revisions of "SJ05435"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPYL-ALCOHOL SINAPYL-ALCOHOL] == * common-name: ** sinapyl alcohol * smiles: ** coc1(c=c(c=c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=18S-rRNA-N6-dimethyladenine1779-1780 18S-rRNA-N6-dimethyladenine1779-1780] == * common-name: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPYL-ALCOHOL SINAPYL-ALCOHOL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=18S-rRNA-N6-dimethyladenine1779-1780 18S-rRNA-N6-dimethyladenine1779-1780] ==
 
* common-name:
 
* common-name:
** sinapyl alcohol
+
** an n6-dimethyladenine1779/n6-dimethyladenine1780 in 18s rrna
* smiles:
 
** coc1(c=c(c=cco)c=c(oc)c(o)=1)
 
* inchi-key:
 
** lzfopexouvtgjs-onegzznksa-n
 
* molecular-weight:
 
** 210.229
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1125]]
+
* [[RXN-11634]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=sinapyl alcohol}}
+
{{#set: common-name=an n6-dimethyladenine1779/n6-dimethyladenine1780 in 18s rrna}}
{{#set: inchi-key=inchikey=lzfopexouvtgjs-onegzznksa-n}}
 
{{#set: molecular-weight=210.229}}
 

Revision as of 09:24, 27 August 2019

Metabolite 18S-rRNA-N6-dimethyladenine1779-1780

  • common-name:
    • an n6-dimethyladenine1779/n6-dimethyladenine1780 in 18s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality