Difference between revisions of "SJ05451"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-CYTIDINE-5-DIPHOSPHO-2-C 4-CYTIDINE-5-DIPHOSPHO-2-C] == * common-name: ** 4-(cytidine 5'-diph...")
 
(Created page with "Category:gene == Gene SJ05451 == * transcription-direction: ** positive * right-end-position: ** 69239 * left-end-position: ** 62237 * centisome-position: ** 67.700424...")
 
(9 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-CYTIDINE-5-DIPHOSPHO-2-C 4-CYTIDINE-5-DIPHOSPHO-2-C] ==
+
== Gene SJ05451 ==
−
* common-name:
+
* transcription-direction:
−
** 4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol
+
** positive
−
* smiles:
+
* right-end-position:
−
** cc(o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o
+
** 69239
−
* inchi-key:
+
* left-end-position:
−
** yfaukwznpvbcff-xhibxcghsa-l
+
** 62237
−
* molecular-weight:
+
* centisome-position:
−
** 519.295
+
** 67.700424   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[2.7.1.148-RXN]]
+
* [[S.japonica_carotenoid_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
* [[2.7.7.60-RXN]]
+
* [[2.7.11.25-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
−
{{#set: common-name=4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: inchi-key=inchikey=yfaukwznpvbcff-xhibxcghsa-l}}
+
* [[PROTEIN-KINASE-RXN]]
−
{{#set: molecular-weight=519.295}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=69239}}
 +
{{#set: left-end-position=62237}}
 +
{{#set: centisome-position=67.700424    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}

Latest revision as of 11:03, 18 March 2021

Gene SJ05451

  • transcription-direction:
    • positive
  • right-end-position:
    • 69239
  • left-end-position:
    • 62237
  • centisome-position:
    • 67.700424

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ05451&oldid=132923"