Difference between revisions of "SJ05457"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-787 CPD-787] == * common-name: ** (2z,4z)-2-hydroxyhepta-2,4-dienedioate * smiles: ** c([o-...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=trans-delta2-behenoyl-ACPs trans-delta2-behenoyl-ACPs] == * common-name: ** a trans-docos-2-eno...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-787 CPD-787] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=trans-delta2-behenoyl-ACPs trans-delta2-behenoyl-ACPs] ==
 
* common-name:
 
* common-name:
** (2z,4z)-2-hydroxyhepta-2,4-dienedioate
+
** a trans-docos-2-enoyl-[acp]
* smiles:
 
** c([o-])(=o)cc=cc=c(o)c(=o)[o-]
 
* inchi-key:
 
** zbcbetmbsdtinl-nwjcxacmsa-l
 
* molecular-weight:
 
** 170.121
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN1K-87]]
+
* [[RXN1G-488]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN1G-363]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2z,4z)-2-hydroxyhepta-2,4-dienedioate}}
+
{{#set: common-name=a trans-docos-2-enoyl-[acp]}}
{{#set: inchi-key=inchikey=zbcbetmbsdtinl-nwjcxacmsa-l}}
 
{{#set: molecular-weight=170.121}}
 

Revision as of 09:23, 27 August 2019

Metabolite trans-delta2-behenoyl-ACPs

  • common-name:
    • a trans-docos-2-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a trans-docos-2-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.