Difference between revisions of "SJ05510"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPALDEHYDE SINAPALDEHYDE] == * common-name: ** sinapaldehyde * smiles: ** coc1(c=c(c=cc=o)c=...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-PRENYLPHLORISOBUTYROPHENONE 4-PRENYLPHLORISOBUTYROPHENONE] == * common-name: ** 4-prenylphlor...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-PRENYLPHLORISOBUTYROPHENONE 4-PRENYLPHLORISOBUTYROPHENONE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-prenylphlorisobutyrophenone |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=ccc1(=c(c=c(c(=c1o)c(c(c)c)=o)o)[o-]))c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** iobxamcsycvnet-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 263.313 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-7813]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-prenylphlorisobutyrophenone}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=iobxamcsycvnet-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=263.313}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite 4-PRENYLPHLORISOBUTYROPHENONE
- common-name:
- 4-prenylphlorisobutyrophenone
- smiles:
- cc(=ccc1(=c(c=c(c(=c1o)c(c(c)c)=o)o)[o-]))c
- inchi-key:
- iobxamcsycvnet-uhfffaoysa-m
- molecular-weight:
- 263.313
