Difference between revisions of "SJ05532"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-96 CPD1F-96] == * common-name: ** gibberellin a19 * smiles: ** c=c1(c2(o)(cc3(c1)(c([ch]4...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7107 CPD-7107] == * common-name: ** deoxycohumulone * smiles: ** cc(=ccc1(=c(c(=c(c(=c1[o-]...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7107 CPD-7107] == |
* common-name: | * common-name: | ||
| − | ** | + | ** deoxycohumulone |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=ccc1(=c(c(=c(c(=c1[o-])cc=c(c)c)o)c(c(c)c)=o)o))c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kkfizykkqlwbkh-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 331.431 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-7813]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=deoxycohumulone}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kkfizykkqlwbkh-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=331.431}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-7107
- common-name:
- deoxycohumulone
- smiles:
- cc(=ccc1(=c(c(=c(c(=c1[o-])cc=c(c)c)o)c(c(c)c)=o)o))c
- inchi-key:
- kkfizykkqlwbkh-uhfffaoysa-m
- molecular-weight:
- 331.431
