Difference between revisions of "SJ05532"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7107 CPD-7107] == * common-name: ** deoxycohumulone * smiles: ** cc(=ccc1(=c(c(=c(c(=c1[o-]...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OH-HEXANOYL-COA OH-HEXANOYL-COA] == * common-name: ** (s)-3-hydroxyhexanoyl-coa * smiles: ** cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7107 CPD-7107] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OH-HEXANOYL-COA OH-HEXANOYL-COA] ==
 
* common-name:
 
* common-name:
** deoxycohumulone
+
** (s)-3-hydroxyhexanoyl-coa
 
* smiles:
 
* smiles:
** cc(=ccc1(=c(c(=c(c(=c1[o-])cc=c(c)c)o)c(c(c)c)=o)o))c
+
** cccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
 
* inchi-key:
 
* inchi-key:
** kkfizykkqlwbkh-uhfffaoysa-m
+
** vaahkrmgofiorx-dwufxmdisa-j
 
* molecular-weight:
 
* molecular-weight:
** 331.431
+
** 877.646
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ECOAH2h]]
 +
* [[HACD2h]]
 +
* [[RXN-12567]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7813]]
+
* [[ECOAH2h]]
 +
* [[HACD2h]]
 +
* [[RXN-12570]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=deoxycohumulone}}
+
{{#set: common-name=(s)-3-hydroxyhexanoyl-coa}}
{{#set: inchi-key=inchikey=kkfizykkqlwbkh-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=vaahkrmgofiorx-dwufxmdisa-j}}
{{#set: molecular-weight=331.431}}
+
{{#set: molecular-weight=877.646}}

Revision as of 09:24, 27 August 2019

Metabolite OH-HEXANOYL-COA

  • common-name:
    • (s)-3-hydroxyhexanoyl-coa
  • smiles:
    • cccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
  • inchi-key:
    • vaahkrmgofiorx-dwufxmdisa-j
  • molecular-weight:
    • 877.646

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality