Difference between revisions of "SJ05532"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OH-HEXANOYL-COA OH-HEXANOYL-COA] == * common-name: ** (s)-3-hydroxyhexanoyl-coa * smiles: ** cc...")
(Created page with "Category:gene == Gene SJ21686 == * transcription-direction: ** positive * right-end-position: ** 631108 * left-end-position: ** 596235 * centisome-position: ** 52.707855...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OH-HEXANOYL-COA OH-HEXANOYL-COA] ==
+
== Gene SJ21686 ==
−
* common-name:
+
* transcription-direction:
−
** (s)-3-hydroxyhexanoyl-coa
+
** positive
−
* smiles:
+
* right-end-position:
−
** cccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
+
** 631108
−
* inchi-key:
+
* left-end-position:
−
** vaahkrmgofiorx-dwufxmdisa-j
+
** 596235
−
* molecular-weight:
+
* centisome-position:
−
** 877.646
+
** 52.707855   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[ECOAH2h]]
+
* [[S.japonica_sterols_curated]]
−
* [[HACD2h]]
+
== Reaction(s) associated ==
−
* [[RXN-12567]]
+
* [[RXN-15561]]
−
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
−
* [[ECOAH2h]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[HACD2h]]
+
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
−
* [[RXN-12570]]
+
** Category: [[annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: common-name=(s)-3-hydroxyhexanoyl-coa}}
+
== Pathway(s) associated ==
−
{{#set: inchi-key=inchikey=vaahkrmgofiorx-dwufxmdisa-j}}
+
* [[PWY-7511]]
−
{{#set: molecular-weight=877.646}}
+
** '''7''' reactions found over '''9''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=631108}}
 +
{{#set: left-end-position=596235}}
 +
{{#set: centisome-position=52.707855    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:21, 18 December 2020

Gene SJ21686

  • transcription-direction:
    • positive
  • right-end-position:
    • 631108
  • left-end-position:
    • 596235
  • centisome-position:
    • 52.707855

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7511
    • 7 reactions found over 9 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ05532&oldid=41681"