Difference between revisions of "SJ05556"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-PROPIONYL-COA 3-HYDROXY-PROPIONYL-COA] == * common-name: ** 3-hydroxypropanoyl-coa *...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Phos-G-protein-coupled-receptors Phos-G-protein-coupled-receptors] == * common-name: ** a phosp...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-PROPIONYL-COA 3-HYDROXY-PROPIONYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Phos-G-protein-coupled-receptors Phos-G-protein-coupled-receptors] ==
 
* common-name:
 
* common-name:
** 3-hydroxypropanoyl-coa
+
** a phosphorylated g protein-coupled receptor
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cco)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** berbfzcusmqabm-iexphmlfsa-j
 
* molecular-weight:
 
** 835.566
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HICH]]
+
* [[2.7.11.16-RXN]]
* [[RXN-6383]]
 
* [[RXN-6384]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-6383]]
+
* [[2.7.11.16-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-hydroxypropanoyl-coa}}
+
{{#set: common-name=a phosphorylated g protein-coupled receptor}}
{{#set: inchi-key=inchikey=berbfzcusmqabm-iexphmlfsa-j}}
 
{{#set: molecular-weight=835.566}}
 

Revision as of 09:24, 27 August 2019

Metabolite Phos-G-protein-coupled-receptors

  • common-name:
    • a phosphorylated g protein-coupled receptor

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality