Difference between revisions of "SJ05645"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-431 CPD-431] == * common-name: ** apigenin * smiles: ** c1(c=c(o)c=cc=1c3(=cc(=o)c2(=c(c=c(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-Lactams Beta-Lactams] == * common-name: ** a β-lactam == Reaction(s) known to consume...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-431 CPD-431] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-Lactams Beta-Lactams] ==
 
* common-name:
 
* common-name:
** apigenin
+
** a β-lactam
* smiles:
 
** c1(c=c(o)c=cc=1c3(=cc(=o)c2(=c(c=c([o-])c=c(o)2)o3)))
 
* inchi-key:
 
** kznifhplkgyrtm-uhfffaoysa-m
 
* molecular-weight:
 
** 269.233
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7651]]
+
* [[BETA-LACTAMASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=apigenin}}
+
{{#set: common-name=a β-lactam}}
{{#set: inchi-key=inchikey=kznifhplkgyrtm-uhfffaoysa-m}}
 
{{#set: molecular-weight=269.233}}
 

Revision as of 09:23, 27 August 2019

Metabolite Beta-Lactams

  • common-name:
    • a β-lactam

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality