Difference between revisions of "SJ05676"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDROXY-METHYL-BUTENYL-DIP HYDROXY-METHYL-BUTENYL-DIP] == * common-name: ** (e)-4-hydroxy-3-met...")
(Created page with "Category:gene == Gene SJ05676 == * transcription-direction: ** negative * right-end-position: ** 148865 * left-end-position: ** 148065 * centisome-position: ** 30.03414...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDROXY-METHYL-BUTENYL-DIP HYDROXY-METHYL-BUTENYL-DIP] ==
+
== Gene SJ05676 ==
* common-name:
+
* transcription-direction:
** (e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate
+
** negative
* smiles:
+
* right-end-position:
** cc(co)=ccop(op([o-])(=o)[o-])(=o)[o-]
+
** 148865
* inchi-key:
+
* left-end-position:
** mdsizrkjvdmqoq-gorduthdsa-k
+
** 148065
* molecular-weight:
+
* centisome-position:
** 259.069
+
** 30.03414   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[HDS]]
+
* [[S.japonica_carotenoid_curated]]
* [[IDS1]]
+
== Reaction(s) associated ==
* [[IDS2]]
+
* [[2.7.12.1-RXN]]
* [[ISPH2-RXN]]
+
** Category: [[annotation]]
* [[RXN0-884]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
== Reaction(s) known to produce the compound ==
+
* [[PROTEIN-KINASE-RXN]]
* [[HDS]]
+
** Category: [[annotation]]
* [[RXN-15878]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN0-882]]
+
** Category: [[orthology]]
== Reaction(s) of unknown directionality ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
{{#set: common-name=(e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate}}
+
* [[RXN-14906]]
{{#set: inchi-key=inchikey=mdsizrkjvdmqoq-gorduthdsa-k}}
+
** Category: [[annotation]]
{{#set: molecular-weight=259.069}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=148865}}
 +
{{#set: left-end-position=148065}}
 +
{{#set: centisome-position=30.03414    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=3}}

Latest revision as of 11:03, 18 March 2021

Gene SJ05676

  • transcription-direction:
    • negative
  • right-end-position:
    • 148865
  • left-end-position:
    • 148065
  • centisome-position:
    • 30.03414

Organism(s) associated with this gene

Reaction(s) associated