Difference between revisions of "SJ05681"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-239 CPD-239] == * common-name: ** cysteamine * smiles: ** c(cs)[n+] * inchi-key: ** ufulayf...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11281 CPD-11281] == * common-name: ** s-sulfanylglutathione * smiles: ** c(ss)c(c(ncc([o-])...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11281 CPD-11281] == |
* common-name: | * common-name: | ||
| − | ** | + | ** s-sulfanylglutathione |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(ss)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qbolvlbsugjhgb-wdskdsinsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 338.373 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[FESGSHTHIO-RXN]] |
| + | * [[RXN-13161]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=s-sulfanylglutathione}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qbolvlbsugjhgb-wdskdsinsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=338.373}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-11281
- common-name:
- s-sulfanylglutathione
- smiles:
- c(ss)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
- inchi-key:
- qbolvlbsugjhgb-wdskdsinsa-m
- molecular-weight:
- 338.373
